C17H19N5O2 — CID 135774031
7-cyclopropyl-10-phenyldiazenyl-3-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodec-9-en-11-one (PubChem CID 135774031) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 7-cyclopropyl-10-phenyldiazenyl-3-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodec-9-en-11-one.
| Compound Name | 7-cyclopropyl-10-phenyldiazenyl-3-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodec-9-en-11-one |
|---|---|
| PubChem CID | 135774031 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 7-cyclopropyl-10-phenyldiazenyl-3-oxa-1,8,12-triazatricyclo[7.3.0.02,6]dodec-9-en-11-one |
| SMILES | O=c1[nH]n2c(c1/N=N/c1ccccc1)NC(C1CC1)C1CCOC12 |
| InChI | InChI=1S/C17H19N5O2/c23-16-14(20-19-11-4-2-1-3-5-11)15-18-13(10-6-7-10)12-8-9-24-17(12)22(15)21-16/h1-5,10,12-13,17-18H,6-9H2,(H,21,23)/b20-19+ |
| InChIKey | RWDOREPNMHBEFB-FMQUCBEESA-N |
| XLogP | 3.33 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|