C21H19N5O4 — CID 135774114
[4-(6-acetamido-9-oxo-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-2-yl)phenyl]methyl-methylcarbamic acid (PubChem CID 135774114) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is [4-(6-acetamido-9-oxo-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-2-yl)phenyl]methyl-methylcarbamic acid.
| Compound Name | [4-(6-acetamido-9-oxo-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-2-yl)phenyl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 135774114 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [4-(6-acetamido-9-oxo-3,10,11-triazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13),11-pentaen-2-yl)phenyl]methyl-methylcarbamic acid |
| SMILES | CC(=O)Nc1cc2c3c(c(-c4ccc(CN(C)C(=O)O)cc4)[nH]c3c1)C=NNC2=O |
| InChI | InChI=1S/C21H19N5O4/c1-11(27)23-14-7-15-18-16(9-22-25-20(15)28)19(24-17(18)8-14)13-5-3-12(4-6-13)10-26(2)21(29)30/h3-9,24H,10H2,1-2H3,(H,23,27)(H,25,28)(H,29,30) |
| InChIKey | ITWUUPIXQBTTBA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |