C14H25N4O+ — CID 135774823
2-(4-ethylpiperazin-4-ium-1-yl)-4-methyl-5-propyl-1H-pyrimidin-6-one (PubChem CID 135774823) has the molecular formula C14H25N4O+ and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-4-ium-1-yl)-4-methyl-5-propyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-ethylpiperazin-4-ium-1-yl)-4-methyl-5-propyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135774823 |
| Molecular Formula | C14H25N4O+ |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(4-ethylpiperazin-4-ium-1-yl)-4-methyl-5-propyl-1H-pyrimidin-6-one |
| SMILES | CCCc1c(C)nc(N2CC[NH+](CC)CC2)[nH]c1=O |
| InChI | InChI=1S/C14H24N4O/c1-4-6-12-11(3)15-14(16-13(12)19)18-9-7-17(5-2)8-10-18/h4-10H2,1-3H3,(H,15,16,19)/p+1 |
| InChIKey | TVHOYXVJEKLNEM-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |