About 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol
4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 135775650) has the molecular formula C20H20INO3
and a molecular weight of 449.29 g/mol. Its IUPAC name is 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol.
Molecular Properties
| Compound Name | 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol |
| PubChem CID | 135775650 |
| Molecular Formula | C20H20INO3 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | COc1cc(/C=C(/CC[C@@H]2C=CCO2)c2ccccn2)cc(I)c1O |
| InChI | InChI=1S/C20H20INO3/c1-24-19-13-14(12-17(21)20(19)23)11-15(18-6-2-3-9-22-18)7-8-16-5-4-10-25-16/h2-6,9,11-13,16,23H,7-8,10H2,1H3/b15-11-/t16-/m0/s1 |
| InChIKey | QLZAESKUQGCOFO-QZFKAFNDSA-N |
| XLogP | 4.68 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol?
The IUPAC name of 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol (CID 135775650) is 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol.
What is the SMILES notation for 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol?
The canonical SMILES for 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol is COc1cc(/C=C(/CC[C@@H]2C=CCO2)c2ccccn2)cc(I)c1O.
What is the InChIKey of 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol?
The InChIKey is QLZAESKUQGCOFO-QZFKAFNDSA-N. The full InChI is InChI=1S/C20H20INO3/c1-24-19-13-14(12-17(21)20(19)23)11-15(18-6-2-3-9-22-18)7-8-16-5-4-10-25-16/h2-6,9,11-13,16,23H,7-8,10H2,1H3/b15-11-/t16-/m0/s1.
What are the key properties of 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol?
4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol has a molecular weight of 449.29 g/mol, XLogP of 4.68, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-4-[(2R)-2,5-dihydrofuran-2-yl]-2-pyridin-2-ylbut-1-enyl]-2-iodo-6-methoxyphenol is sourced from PubChem (CID 135775650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).