About (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate (PubChem CID 135775930) has the molecular formula C16H14N2O4S
and a molecular weight of 330.37 g/mol. Its IUPAC name is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate.
Molecular Properties
| Compound Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate |
| PubChem CID | 135775930 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate |
| SMILES | CC(Oc1ccccc1)C(=O)OCc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H14N2O4S/c1-10(22-11-5-3-2-4-6-11)16(20)21-9-13-17-12-7-8-23-14(12)15(19)18-13/h2-8,10H,9H2,1H3,(H,17,18,19) |
| InChIKey | OOQLFDSLKMDIDT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate?
The IUPAC name of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate (CID 135775930) is (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate.
What is the SMILES notation for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate?
The canonical SMILES for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate is CC(Oc1ccccc1)C(=O)OCc1nc2ccsc2c(=O)[nH]1.
What is the InChIKey of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate?
The InChIKey is OOQLFDSLKMDIDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4S/c1-10(22-11-5-3-2-4-6-11)16(20)21-9-13-17-12-7-8-23-14(12)15(19)18-13/h2-8,10H,9H2,1H3,(H,17,18,19).
What are the key properties of (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate?
(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate has a molecular weight of 330.37 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl 2-phenoxypropanoate is sourced from PubChem (CID 135775930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).