About ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate
ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate (PubChem CID 135776301) has the molecular formula C15H17NO3S
and a molecular weight of 291.37 g/mol. Its IUPAC name is ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
| PubChem CID | 135776301 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate |
| SMILES | CCOC(=O)C1=C(O)CS/C1=N\c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H17NO3S/c1-4-19-15(18)13-12(17)8-20-14(13)16-11-6-5-9(2)10(3)7-11/h5-7,17H,4,8H2,1-3H3/b16-14- |
| InChIKey | PRWSXVAFZWFLAK-PEZBUJJGSA-N |
| XLogP | 3.46 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate?
The IUPAC name of ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate (CID 135776301) is ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate.
What is the SMILES notation for ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate?
The canonical SMILES for ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate is CCOC(=O)C1=C(O)CS/C1=N\c1ccc(C)c(C)c1.
What is the InChIKey of ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate?
The InChIKey is PRWSXVAFZWFLAK-PEZBUJJGSA-N. The full InChI is InChI=1S/C15H17NO3S/c1-4-19-15(18)13-12(17)8-20-14(13)16-11-6-5-9(2)10(3)7-11/h5-7,17H,4,8H2,1-3H3/b16-14-.
What are the key properties of ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate?
ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate has a molecular weight of 291.37 g/mol, XLogP of 3.46, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(3,4-dimethylphenyl)imino-3-hydroxy-2H-thiophene-4-carboxylate is sourced from PubChem (CID 135776301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).