C15H12ClFN6O3 — CID 135776460
N-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide (PubChem CID 135776460) has the molecular formula C15H12ClFN6O3 and a molecular weight of 378.75 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135776460 |
| Molecular Formula | C15H12ClFN6O3 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]-5-methylpyrazol-3-yl]-5-nitro-1H-pyrazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc([N+](=O)[O-])[nH]n2)nn1Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H12ClFN6O3/c1-8-4-13(18-15(24)12-6-14(20-19-12)23(25)26)21-22(8)7-9-2-3-10(17)5-11(9)16/h2-6H,7H2,1H3,(H,19,20)(H,18,21,24) |
| InChIKey | BJBNMBUKOXMZMB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 118.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|