C24H32N4O — CID 135776600
(E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 135776600) has the molecular formula C24H32N4O and a molecular weight of 392.55 g/mol. Its IUPAC name is (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 135776600 |
| Molecular Formula | C24H32N4O |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | (E)-3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | CC(C)(C)c1cc(/C=C(\C#N)c2nnc3n2CCCCC3)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C24H32N4O/c1-23(2,3)18-13-16(14-19(21(18)29)24(4,5)6)12-17(15-25)22-27-26-20-10-8-7-9-11-28(20)22/h12-14,29H,7-11H2,1-6H3/b17-12+ |
| InChIKey | FOZBTXVUGOFNNC-SFQUDFHCSA-N |
| XLogP | 5.37 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|