C13H15N3S2 — CID 135777093
N-cyclopropyl-5-(4-methylsulfanylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135777093) has the molecular formula C13H15N3S2 and a molecular weight of 277.42 g/mol. Its IUPAC name is N-cyclopropyl-5-(4-methylsulfanylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-cyclopropyl-5-(4-methylsulfanylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135777093 |
| Molecular Formula | C13H15N3S2 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-cyclopropyl-5-(4-methylsulfanylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CSc1ccc(C2=NN/C(=N/C3CC3)SC2)cc1 |
| InChI | InChI=1S/C13H15N3S2/c1-17-11-6-2-9(3-7-11)12-8-18-13(16-15-12)14-10-4-5-10/h2-3,6-7,10H,4-5,8H2,1H3,(H,14,16) |
| InChIKey | NXOQMWARSJHBBZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|