C24H29NO6S — CID 135779499
4-[(Z,5R)-5-[(2R)-2,4-bis(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-5-hydroxy-2-pyridin-2-ylpent-1-enyl]-2,6-dimethylphenol (PubChem CID 135779499) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is 4-[(Z,5R)-5-[(2R)-2,4-bis(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-5-hydroxy-2-pyridin-2-ylpent-1-enyl]-2,6-dimethylphenol.
| Compound Name | 4-[(Z,5R)-5-[(2R)-2,4-bis(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-5-hydroxy-2-pyridin-2-ylpent-1-enyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 135779499 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-[(Z,5R)-5-[(2R)-2,4-bis(hydroxymethyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]-5-hydroxy-2-pyridin-2-ylpent-1-enyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(/C=C(/CC[C@@H](O)C2=C(CO)CS(=O)(=O)[C@H]2CO)c2ccccn2)cc(C)c1O |
| InChI | InChI=1S/C24H29NO6S/c1-15-9-17(10-16(2)24(15)29)11-18(20-5-3-4-8-25-20)6-7-21(28)23-19(12-26)14-32(30,31)22(23)13-27/h3-5,8-11,21-22,26-29H,6-7,12-14H2,1-2H3/b18-11-/t21-,22+/m1/s1 |
| InChIKey | HPYSAOYLJSCALB-NUTRMJNFSA-N |
| XLogP | 2.16 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|