C6H6N4O — CID 135780309
3-methyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 135780309) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 3-methyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135780309 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 3-methyl-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | Cc1[nH]nc2nc[nH]c(=O)c12 |
| InChI | InChI=1S/C6H6N4O/c1-3-4-5(10-9-3)7-2-8-6(4)11/h2H,1H3,(H2,7,8,9,10,11) |
| InChIKey | GPHQGGGMWLLWMC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |