C13H12N2O3 — CID 135781724
N-[(Z)-(4-hydroxyphenyl)methylideneamino]-2-methylfuran-3-carboxamide (PubChem CID 135781724) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxyphenyl)methylideneamino]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(Z)-(4-hydroxyphenyl)methylideneamino]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 135781724 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[(Z)-(4-hydroxyphenyl)methylideneamino]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N/N=C\c1ccc(O)cc1 |
| InChI | InChI=1S/C13H12N2O3/c1-9-12(6-7-18-9)13(17)15-14-8-10-2-4-11(16)5-3-10/h2-8,16H,1H3,(H,15,17)/b14-8- |
| InChIKey | CNJIISPUPSVKQD-ZSOIEALJSA-N |
| XLogP | 2.06 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|