C29H17N5O3S2 — CID 135782633
(2E)-2-(3H-1,3-benzothiazol-2-ylidene)-1-imino-3-[5-(4-nitrophenyl)furan-2-yl]-3H-pyrido[2,1-b][1,3]benzothiazole-4-carbonitrile (PubChem CID 135782633) has the molecular formula C29H17N5O3S2 and a molecular weight of 547.62 g/mol. Its IUPAC name is (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-1-imino-3-[5-(4-nitrophenyl)furan-2-yl]-3H-pyrido[2,1-b][1,3]benzothiazole-4-carbonitrile.
| Compound Name | (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-1-imino-3-[5-(4-nitrophenyl)furan-2-yl]-3H-pyrido[2,1-b][1,3]benzothiazole-4-carbonitrile |
|---|---|
| PubChem CID | 135782633 |
| Molecular Formula | C29H17N5O3S2 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | (2E)-2-(3H-1,3-benzothiazol-2-ylidene)-1-imino-3-[5-(4-nitrophenyl)furan-2-yl]-3H-pyrido[2,1-b][1,3]benzothiazole-4-carbonitrile |
| SMILES | [H]/N=C1C(=C2\Nc3ccccc3S2)/C(c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)C(C#N)=C2Sc3ccccc3N2/1 |
| InChI | InChI=1S/C29H17N5O3S2/c30-15-18-25(22-14-13-21(37-22)16-9-11-17(12-10-16)34(35)36)26(28-32-19-5-1-3-7-23(19)38-28)27(31)33-20-6-2-4-8-24(20)39-29(18)33/h1-14,25,31-32H/b28-26+,31-27- |
| InChIKey | AGCFZVGSCWBVCL-ZQKGQMFGSA-N |
| XLogP | 7.71 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|