C16H25N3O2S — CID 135783256
N-cycloheptyl-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide (PubChem CID 135783256) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N-cycloheptyl-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide.
| Compound Name | N-cycloheptyl-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide |
|---|---|
| PubChem CID | 135783256 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N-cycloheptyl-3-(4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidin-5-yl)propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)NC2CCCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H25N3O2S/c1-11-13(15(21)19-16(17-11)22-2)9-10-14(20)18-12-7-5-3-4-6-8-12/h12H,3-10H2,1-2H3,(H,18,20)(H,17,19,21) |
| InChIKey | FGMXQRLJNIHAJO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |