About [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea
[(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea (PubChem CID 135783342) has the molecular formula C13H18N4O2S
and a molecular weight of 294.38 g/mol. Its IUPAC name is [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea |
| PubChem CID | 135783342 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1ccc(O)c(CN2CCCC2)c1O |
| InChI | InChI=1S/C13H18N4O2S/c14-13(20)16-15-7-9-3-4-11(18)10(12(9)19)8-17-5-1-2-6-17/h3-4,7,18-19H,1-2,5-6,8H2,(H3,14,16,20)/b15-7+ |
| InChIKey | PUIJRYAKOUXFBV-VIZOYTHASA-N |
| XLogP | 0.86 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The IUPAC name of [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea (CID 135783342) is [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea.
What is the SMILES notation for [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The canonical SMILES for [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea is NC(=S)N/N=C/c1ccc(O)c(CN2CCCC2)c1O.
What is the InChIKey of [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The InChIKey is PUIJRYAKOUXFBV-VIZOYTHASA-N. The full InChI is InChI=1S/C13H18N4O2S/c14-13(20)16-15-7-9-3-4-11(18)10(12(9)19)8-17-5-1-2-6-17/h3-4,7,18-19H,1-2,5-6,8H2,(H3,14,16,20)/b15-7+.
What are the key properties of [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
[(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea has a molecular weight of 294.38 g/mol, XLogP of 0.86, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2,4-dihydroxy-3-(pyrrolidin-1-ylmethyl)phenyl]methylideneamino]thiourea is sourced from PubChem (CID 135783342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).