About [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea
[(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea (PubChem CID 135783343) has the molecular formula C14H20N4O2S
and a molecular weight of 308.41 g/mol. Its IUPAC name is [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea |
| PubChem CID | 135783343 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C/c1ccc(O)c(CN2CCCCC2)c1O |
| InChI | InChI=1S/C14H20N4O2S/c15-14(21)17-16-8-10-4-5-12(19)11(13(10)20)9-18-6-2-1-3-7-18/h4-5,8,19-20H,1-3,6-7,9H2,(H3,15,17,21)/b16-8+ |
| InChIKey | OAKGBESQBGCJJE-LZYBPNLTSA-N |
| XLogP | 1.25 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The IUPAC name of [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea (CID 135783343) is [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea.
What is the SMILES notation for [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The canonical SMILES for [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea is NC(=S)N/N=C/c1ccc(O)c(CN2CCCCC2)c1O.
What is the InChIKey of [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
The InChIKey is OAKGBESQBGCJJE-LZYBPNLTSA-N. The full InChI is InChI=1S/C14H20N4O2S/c15-14(21)17-16-8-10-4-5-12(19)11(13(10)20)9-18-6-2-1-3-7-18/h4-5,8,19-20H,1-3,6-7,9H2,(H3,15,17,21)/b16-8+.
What are the key properties of [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea?
[(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea has a molecular weight of 308.41 g/mol, XLogP of 1.25, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-[2,4-dihydroxy-3-(piperidin-1-ylmethyl)phenyl]methylideneamino]thiourea is sourced from PubChem (CID 135783343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).