C14H13N3O5S — CID 135783691
N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 135783691) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 135783691 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2ccc(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C14H13N3O5S/c1-10-2-5-12(6-3-10)23(21,22)16-15-9-11-4-7-14(18)13(8-11)17(19)20/h2-9,16,18H,1H3/b15-9- |
| InChIKey | ULWWBGXLVQEIDO-DHDCSXOGSA-N |
| XLogP | 1.92 |
| TPSA | 121.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|