About 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one
5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 135783923) has the molecular formula C8H9ClN4O
and a molecular weight of 212.64 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 135783923 |
| Molecular Formula | C8H9ClN4O |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1nn(C)c2c(=O)[nH]c(CCl)nc12 |
| InChI | InChI=1S/C8H9ClN4O/c1-4-6-7(13(2)12-4)8(14)11-5(3-9)10-6/h3H2,1-2H3,(H,10,11,14) |
| InChIKey | NHTSOGLMRVPDLN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one (CID 135783923) is 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is Cc1nn(C)c2c(=O)[nH]c(CCl)nc12.
What is the InChIKey of 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is NHTSOGLMRVPDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN4O/c1-4-6-7(13(2)12-4)8(14)11-5(3-9)10-6/h3H2,1-2H3,(H,10,11,14).
What are the key properties of 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one?
5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 212.64 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-1,3-dimethyl-6H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 135783923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).