About 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine
7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine (PubChem CID 135783989) has the molecular formula C18H13BrClN3
and a molecular weight of 386.68 g/mol. Its IUPAC name is 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
Molecular Properties
| Compound Name | 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| PubChem CID | 135783989 |
| Molecular Formula | C18H13BrClN3 |
| Molecular Weight | 386.68 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| SMILES | C#CC/N=C1\CN=C(c2ccccc2Cl)c2cc(Br)ccc2N1 |
| InChI | InChI=1S/C18H13BrClN3/c1-2-9-21-17-11-22-18(13-5-3-4-6-15(13)20)14-10-12(19)7-8-16(14)23-17/h1,3-8,10H,9,11H2,(H,21,23) |
| InChIKey | BTOWFRWBMOVLNF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.68 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine?
The IUPAC name of 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine (CID 135783989) is 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine.
What is the SMILES notation for 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine?
The canonical SMILES for 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine is C#CC/N=C1\CN=C(c2ccccc2Cl)c2cc(Br)ccc2N1.
What is the InChIKey of 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine?
The InChIKey is BTOWFRWBMOVLNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrClN3/c1-2-9-21-17-11-22-18(13-5-3-4-6-15(13)20)14-10-12(19)7-8-16(14)23-17/h1,3-8,10H,9,11H2,(H,21,23).
What are the key properties of 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine?
7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine has a molecular weight of 386.68 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-5-(2-chlorophenyl)-N-prop-2-ynyl-1,3-dihydro-1,4-benzodiazepin-2-imine is sourced from PubChem (CID 135783989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).