C21H30N2O2 — CID 135784136
4-hydroxy-5,5-dimethyl-3-(octyliminomethyl)-1-phenylpyrrol-2-one (PubChem CID 135784136) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-hydroxy-5,5-dimethyl-3-(octyliminomethyl)-1-phenylpyrrol-2-one.
| Compound Name | 4-hydroxy-5,5-dimethyl-3-(octyliminomethyl)-1-phenylpyrrol-2-one |
|---|---|
| PubChem CID | 135784136 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-hydroxy-5,5-dimethyl-3-(octyliminomethyl)-1-phenylpyrrol-2-one |
| SMILES | CCCCCCCC/N=C/C1=C(O)C(C)(C)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H30N2O2/c1-4-5-6-7-8-12-15-22-16-18-19(24)21(2,3)23(20(18)25)17-13-10-9-11-14-17/h9-11,13-14,16,24H,4-8,12,15H2,1-3H3/b22-16+ |
| InChIKey | APWOYFFMVYTLRB-CJLVFECKSA-N |
| XLogP | 5.06 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|