C11H17N5O — CID 135784973
6-methyl-3-[(2Z)-2-[(2S)-2-methylcyclohexylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135784973) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-methyl-3-[(2Z)-2-[(2S)-2-methylcyclohexylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-[(2Z)-2-[(2S)-2-methylcyclohexylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135784973 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-methyl-3-[(2Z)-2-[(2S)-2-methylcyclohexylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(N/N=C2/CCCC[C@@H]2C)[nH]c1=O |
| InChI | InChI=1S/C11H17N5O/c1-7-5-3-4-6-9(7)14-16-11-12-10(17)8(2)13-15-11/h7H,3-6H2,1-2H3,(H2,12,15,16,17)/b14-9-/t7-/m0/s1 |
| InChIKey | NKTPTXDECXQEGJ-VBYWKDERSA-N |
| XLogP | 1.45 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|