C17H25N5O — CID 135785009
3-[(2Z)-2-[1-(1-adamantyl)propan-2-ylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135785009) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-[(2Z)-2-[1-(1-adamantyl)propan-2-ylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2Z)-2-[1-(1-adamantyl)propan-2-ylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135785009 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 3-[(2Z)-2-[1-(1-adamantyl)propan-2-ylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | C/C(CC12CC3CC(CC(C3)C1)C2)=N/Nc1nnc(C)c(=O)[nH]1 |
| InChI | InChI=1S/C17H25N5O/c1-10(19-21-16-18-15(23)11(2)20-22-16)6-17-7-12-3-13(8-17)5-14(4-12)9-17/h12-14H,3-9H2,1-2H3,(H2,18,21,22,23)/b19-10- |
| InChIKey | FVXYKFQTYWXADF-GRSHGNNSSA-N |
| XLogP | 2.87 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|