C28H33N3O4 — CID 135785646
3-(2-hydroxy-4,6-dimethylphenyl)-4-(3-methoxy-4-pentoxyphenyl)-5-prop-2-enyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135785646) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 3-(2-hydroxy-4,6-dimethylphenyl)-4-(3-methoxy-4-pentoxyphenyl)-5-prop-2-enyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 3-(2-hydroxy-4,6-dimethylphenyl)-4-(3-methoxy-4-pentoxyphenyl)-5-prop-2-enyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135785646 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 3-(2-hydroxy-4,6-dimethylphenyl)-4-(3-methoxy-4-pentoxyphenyl)-5-prop-2-enyl-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | C=CCN1C(=O)c2[nH]nc(-c3c(C)cc(C)cc3O)c2C1c1ccc(OCCCCC)c(OC)c1 |
| InChI | InChI=1S/C28H33N3O4/c1-6-8-9-13-35-21-11-10-19(16-22(21)34-5)27-24-25(23-18(4)14-17(3)15-20(23)32)29-30-26(24)28(33)31(27)12-7-2/h7,10-11,14-16,27,32H,2,6,8-9,12-13H2,1,3-5H3,(H,29,30) |
| InChIKey | RNXRJRXZDPZLEM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 87.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|