C18H22N2O3 — CID 135786496
2-[(4E)-1,8-diethyl-4-hydroxyimino-3,9-dihydro-2H-carbazol-1-yl]acetic acid (PubChem CID 135786496) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[(4E)-1,8-diethyl-4-hydroxyimino-3,9-dihydro-2H-carbazol-1-yl]acetic acid.
| Compound Name | 2-[(4E)-1,8-diethyl-4-hydroxyimino-3,9-dihydro-2H-carbazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 135786496 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[(4E)-1,8-diethyl-4-hydroxyimino-3,9-dihydro-2H-carbazol-1-yl]acetic acid |
| SMILES | CCc1cccc2c3c([nH]c12)C(CC)(CC(=O)O)CC/C3=N\O |
| InChI | InChI=1S/C18H22N2O3/c1-3-11-6-5-7-12-15-13(20-23)8-9-18(4-2,10-14(21)22)17(15)19-16(11)12/h5-7,19,23H,3-4,8-10H2,1-2H3,(H,21,22)/b20-13+ |
| InChIKey | AMAOFSQGAWCOSJ-DEDYPNTBSA-N |
| XLogP | 3.82 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|