C25H26N4O — CID 135786569
4-[4,5-bis[4-(dimethylamino)phenyl]-1H-imidazol-2-yl]phenol (PubChem CID 135786569) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 4-[4,5-bis[4-(dimethylamino)phenyl]-1H-imidazol-2-yl]phenol.
| Compound Name | 4-[4,5-bis[4-(dimethylamino)phenyl]-1H-imidazol-2-yl]phenol |
|---|---|
| PubChem CID | 135786569 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 4-[4,5-bis[4-(dimethylamino)phenyl]-1H-imidazol-2-yl]phenol |
| SMILES | CN(C)c1ccc(-c2nc(-c3ccc(O)cc3)[nH]c2-c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H26N4O/c1-28(2)20-11-5-17(6-12-20)23-24(18-7-13-21(14-8-18)29(3)4)27-25(26-23)19-9-15-22(30)16-10-19/h5-16,30H,1-4H3,(H,26,27) |
| InChIKey | QTIGCKVHRYBEKI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|