C14H17BrN4O2S — CID 135786620
(5E)-5-[(4-bromo-1-ethylpyrazol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 135786620) has the molecular formula C14H17BrN4O2S and a molecular weight of 385.29 g/mol. Its IUPAC name is (5E)-5-[(4-bromo-1-ethylpyrazol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[(4-bromo-1-ethylpyrazol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 135786620 |
| Molecular Formula | C14H17BrN4O2S |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | (5E)-5-[(4-bromo-1-ethylpyrazol-5-yl)methylidene]-3-(oxolan-2-ylmethyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCn1ncc(Br)c1/C=C1/NC(=S)N(CC2CCCO2)C1=O |
| InChI | InChI=1S/C14H17BrN4O2S/c1-2-19-12(10(15)7-16-19)6-11-13(20)18(14(22)17-11)8-9-4-3-5-21-9/h6-7,9H,2-5,8H2,1H3,(H,17,22)/b11-6+ |
| InChIKey | OKWWMMVFVDXHEY-IZZDOVSWSA-N |
| XLogP | 1.90 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|