About 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione
4H-pyrazolo[1,5-a]pyrimidine-5,7-dione (PubChem CID 135787026) has the molecular formula C6H5N3O2
and a molecular weight of 151.12 g/mol. Its IUPAC name is 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione.
Molecular Properties
| Compound Name | 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione |
| PubChem CID | 135787026 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione |
| SMILES | O=C1CC(=O)n2nccc2N1 |
| InChI | InChI=1S/C6H5N3O2/c10-5-3-6(11)9-4(8-5)1-2-7-9/h1-2H,3H2,(H,8,10) |
| InChIKey | WLKWWISJQDPNNJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione?
The IUPAC name of 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione (CID 135787026) is 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione.
What is the SMILES notation for 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione?
The canonical SMILES for 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione is O=C1CC(=O)n2nccc2N1.
What is the InChIKey of 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione?
The InChIKey is WLKWWISJQDPNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2/c10-5-3-6(11)9-4(8-5)1-2-7-9/h1-2H,3H2,(H,8,10).
What are the key properties of 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione?
4H-pyrazolo[1,5-a]pyrimidine-5,7-dione has a molecular weight of 151.12 g/mol, XLogP of -0.13, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrazolo[1,5-a]pyrimidine-5,7-dione is sourced from PubChem (CID 135787026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).