C21H24ClN3O2 — CID 135787435
(5S,7R)-3-chloro-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]adamantane-1-carboxamide (PubChem CID 135787435) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 135787435 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | (5S,7R)-3-chloro-N-methyl-N-[(4-oxo-3H-quinazolin-2-yl)methyl]adamantane-1-carboxamide |
| SMILES | CN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C21H24ClN3O2/c1-25(11-17-23-16-5-3-2-4-15(16)18(26)24-17)19(27)20-7-13-6-14(8-20)10-21(22,9-13)12-20/h2-5,13-14H,6-12H2,1H3,(H,23,24,26)/t13-,14+,20?,21? |
| InChIKey | FLFAUBGPDGAABV-ZXPDZVFASA-N |
| XLogP | 3.46 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|