C16H10ClN5O4 — CID 135788542
N-[(Z)-(2-chlorophenyl)methylideneamino]-6-nitro-4-oxo-3H-quinazoline-2-carboxamide (PubChem CID 135788542) has the molecular formula C16H10ClN5O4 and a molecular weight of 371.74 g/mol. Its IUPAC name is N-[(Z)-(2-chlorophenyl)methylideneamino]-6-nitro-4-oxo-3H-quinazoline-2-carboxamide.
| Compound Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-6-nitro-4-oxo-3H-quinazoline-2-carboxamide |
|---|---|
| PubChem CID | 135788542 |
| Molecular Formula | C16H10ClN5O4 |
| Molecular Weight | 371.74 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[(Z)-(2-chlorophenyl)methylideneamino]-6-nitro-4-oxo-3H-quinazoline-2-carboxamide |
| SMILES | O=C(N/N=C\c1ccccc1Cl)c1nc2ccc([N+](=O)[O-])cc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H10ClN5O4/c17-12-4-2-1-3-9(12)8-18-21-16(24)14-19-13-6-5-10(22(25)26)7-11(13)15(23)20-14/h1-8H,(H,21,24)(H,19,20,23)/b18-8- |
| InChIKey | BVNWERPMTOPLND-LSCVHKIXSA-N |
| XLogP | 2.25 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.74 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|