C7H11N5O — CID 135789116
N,N-dimethyl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)methanimidamide (PubChem CID 135789116) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is N,N-dimethyl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)methanimidamide |
|---|---|
| PubChem CID | 135789116 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N,N-dimethyl-N'-(6-methyl-5-oxo-4H-1,2,4-triazin-3-yl)methanimidamide |
| SMILES | Cc1nnc(/N=C/N(C)C)[nH]c1=O |
| InChI | InChI=1S/C7H11N5O/c1-5-6(13)9-7(11-10-5)8-4-12(2)3/h4H,1-3H3,(H,9,11,13)/b8-4+ |
| InChIKey | VDNHGYFKHVBWOS-XBXARRHUSA-N |
| XLogP | -0.31 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|