About 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate
2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate (PubChem CID 135789951) has the molecular formula C19H22N4O2S
and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate |
| PubChem CID | 135789951 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate |
| SMILES | CCN(CC)CCS/C(=N\O)c1nc(-c2cccc3ccccc23)no1 |
| InChI | InChI=1S/C19H22N4O2S/c1-3-23(4-2)12-13-26-19(21-24)18-20-17(22-25-18)16-11-7-9-14-8-5-6-10-15(14)16/h5-11,24H,3-4,12-13H2,1-2H3/b21-19- |
| InChIKey | SIQPHTVCNYKRND-VZCXRCSSSA-N |
| XLogP | 4.10 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate?
The IUPAC name of 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate (CID 135789951) is 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate.
What is the SMILES notation for 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate?
The canonical SMILES for 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate is CCN(CC)CCS/C(=N\O)c1nc(-c2cccc3ccccc23)no1.
What is the InChIKey of 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate?
The InChIKey is SIQPHTVCNYKRND-VZCXRCSSSA-N. The full InChI is InChI=1S/C19H22N4O2S/c1-3-23(4-2)12-13-26-19(21-24)18-20-17(22-25-18)16-11-7-9-14-8-5-6-10-15(14)16/h5-11,24H,3-4,12-13H2,1-2H3/b21-19-.
What are the key properties of 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate?
2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate has a molecular weight of 370.48 g/mol, XLogP of 4.10, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl (5Z)-N-hydroxy-3-naphthalen-1-yl-1,2,4-oxadiazole-5-carboximidothioate is sourced from PubChem (CID 135789951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).