C8H6BrN5O5 — CID 135790049
methyl 2-[5-(4-bromo-5-nitro-1H-pyrazol-3-yl)-1,3,4-oxadiazol-2-yl]acetate (PubChem CID 135790049) has the molecular formula C8H6BrN5O5 and a molecular weight of 332.07 g/mol. Its IUPAC name is methyl 2-[5-(4-bromo-5-nitro-1H-pyrazol-3-yl)-1,3,4-oxadiazol-2-yl]acetate.
| Compound Name | methyl 2-[5-(4-bromo-5-nitro-1H-pyrazol-3-yl)-1,3,4-oxadiazol-2-yl]acetate |
|---|---|
| PubChem CID | 135790049 |
| Molecular Formula | C8H6BrN5O5 |
| Molecular Weight | 332.07 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | methyl 2-[5-(4-bromo-5-nitro-1H-pyrazol-3-yl)-1,3,4-oxadiazol-2-yl]acetate |
| SMILES | COC(=O)Cc1nnc(-c2n[nH]c([N+](=O)[O-])c2Br)o1 |
| InChI | InChI=1S/C8H6BrN5O5/c1-18-4(15)2-3-10-13-8(19-3)6-5(9)7(12-11-6)14(16)17/h2H2,1H3,(H,11,12) |
| InChIKey | FGXIMWZLQJBLOP-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.07 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|