C19H22N6O5 — CID 135792195
cyclohexyl 7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135792195) has the molecular formula C19H22N6O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is cyclohexyl 7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135792195 |
| Molecular Formula | C19H22N6O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | cyclohexyl 7-(4-methoxy-3-nitrophenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COc1ccc(C2C(C(=O)OC3CCCCC3)=C(C)Nc3nnnn32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N6O5/c1-11-16(18(26)30-13-6-4-3-5-7-13)17(24-19(20-11)21-22-23-24)12-8-9-15(29-2)14(10-12)25(27)28/h8-10,13,17H,3-7H2,1-2H3,(H,20,21,23) |
| InChIKey | OMHOVNWOJNUVTB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|