C31H29Cl2FN4O3S — CID 135792504
butyl 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135792504) has the molecular formula C31H29Cl2FN4O3S and a molecular weight of 627.57 g/mol. Its IUPAC name is butyl 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135792504 |
| Molecular Formula | C31H29Cl2FN4O3S |
| Molecular Weight | 627.57 g/mol |
| Exact Mass | 626.13 |
| IUPAC Name | butyl 7-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-fluorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2nc(SCc3ccccc3F)nn2C1c1ccc(OCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C31H29Cl2FN4O3S/c1-3-4-16-40-29(39)27-19(2)35-30-36-31(42-18-21-8-5-6-11-26(21)34)37-38(30)28(27)20-12-14-22(15-13-20)41-17-23-24(32)9-7-10-25(23)33/h5-15,28H,3-4,16-18H2,1-2H3,(H,35,36,37) |
| InChIKey | KNPRFIAGVKXIAT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.57 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|