About 1,3-diaminourea;1-nitroguanidine
1,3-diaminourea;1-nitroguanidine (PubChem CID 135793883) has the molecular formula C2H10N8O3
and a molecular weight of 194.16 g/mol. Its IUPAC name is 1,3-diaminourea;1-nitroguanidine.
Molecular Properties
| Compound Name | 1,3-diaminourea;1-nitroguanidine |
| PubChem CID | 135793883 |
| Molecular Formula | C2H10N8O3 |
| Molecular Weight | 194.16 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1,3-diaminourea;1-nitroguanidine |
| SMILES | NNC(=O)NN.[H]/N=C(\N)N[N+](=O)[O-] |
| InChI | InChI=1S/CH4N4O2.CH6N4O/c2-1(3)4-5(6)7;2-4-1(6)5-3/h(H4,2,3,4);2-3H2,(H2,4,5,6) |
| InChIKey | NHORDRSXELZXRN-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 198.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 194.16 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diaminourea;1-nitroguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diaminourea;1-nitroguanidine?
The IUPAC name of 1,3-diaminourea;1-nitroguanidine (CID 135793883) is 1,3-diaminourea;1-nitroguanidine.
What is the SMILES notation for 1,3-diaminourea;1-nitroguanidine?
The canonical SMILES for 1,3-diaminourea;1-nitroguanidine is NNC(=O)NN.[H]/N=C(\N)N[N+](=O)[O-].
What is the InChIKey of 1,3-diaminourea;1-nitroguanidine?
The InChIKey is NHORDRSXELZXRN-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N4O2.CH6N4O/c2-1(3)4-5(6)7;2-4-1(6)5-3/h(H4,2,3,4);2-3H2,(H2,4,5,6).
What are the key properties of 1,3-diaminourea;1-nitroguanidine?
1,3-diaminourea;1-nitroguanidine has a molecular weight of 194.16 g/mol, XLogP of -3.31, 1 rotatable bonds, 7 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diaminourea;1-nitroguanidine is sourced from PubChem (CID 135793883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).