About 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone
2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone (PubChem CID 135794165) has the molecular formula C11H17N2O7P
and a molecular weight of 320.24 g/mol. Its IUPAC name is 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone.
Molecular Properties
| Compound Name | 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone |
| PubChem CID | 135794165 |
| Molecular Formula | C11H17N2O7P |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone |
| SMILES | COP(=O)(OC)C(=[N+]=[N-])C(=O)[C@H]1CC2(C[C@H]1O)OCCO2 |
| InChI | InChI=1S/C11H17N2O7P/c1-17-21(16,18-2)10(13-12)9(15)7-5-11(6-8(7)14)19-3-4-20-11/h7-8,14H,3-6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | KRRZISWZJNWXSV-JGVFFNPUSA-N |
| XLogP | 0.18 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone?
The IUPAC name of 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone (CID 135794165) is 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone.
What is the SMILES notation for 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone?
The canonical SMILES for 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone is COP(=O)(OC)C(=[N+]=[N-])C(=O)[C@H]1CC2(C[C@H]1O)OCCO2.
What is the InChIKey of 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone?
The InChIKey is KRRZISWZJNWXSV-JGVFFNPUSA-N. The full InChI is InChI=1S/C11H17N2O7P/c1-17-21(16,18-2)10(13-12)9(15)7-5-11(6-8(7)14)19-3-4-20-11/h7-8,14H,3-6H2,1-2H3/t7-,8+/m0/s1.
What are the key properties of 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone?
2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone has a molecular weight of 320.24 g/mol, XLogP of 0.18, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-2-dimethoxyphosphoryl-1-[(7S,8R)-8-hydroxy-1,4-dioxaspiro[4.4]nonan-7-yl]ethanone is sourced from PubChem (CID 135794165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).