C16H18N6O4 — CID 135795711
tert-butyl 5-methyl-7-(4-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135795711) has the molecular formula C16H18N6O4 and a molecular weight of 358.36 g/mol. Its IUPAC name is tert-butyl 5-methyl-7-(4-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | tert-butyl 5-methyl-7-(4-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135795711 |
| Molecular Formula | C16H18N6O4 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | tert-butyl 5-methyl-7-(4-nitrophenyl)-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C(c2ccc([N+](=O)[O-])cc2)n2nnnc2N1 |
| InChI | InChI=1S/C16H18N6O4/c1-9-12(14(23)26-16(2,3)4)13(21-15(17-9)18-19-20-21)10-5-7-11(8-6-10)22(24)25/h5-8,13H,1-4H3,(H,17,18,20) |
| InChIKey | WCFUHOYDFYGJCP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 125.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|