About 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol
4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol (PubChem CID 135796063) has the molecular formula C15H22N2O
and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol.
Molecular Properties
| Compound Name | 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol |
| PubChem CID | 135796063 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol |
| SMILES | CC(=NN1C(C)CCCC1C)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-11-5-4-6-12(2)17(11)16-13(3)14-7-9-15(18)10-8-14/h7-12,18H,4-6H2,1-3H3 |
| InChIKey | SWUUTRFVWGSLGM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The IUPAC name of 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol (CID 135796063) is 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol.
What is the SMILES notation for 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The canonical SMILES for 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol is CC(=NN1C(C)CCCC1C)c1ccc(O)cc1.
What is the InChIKey of 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
The InChIKey is SWUUTRFVWGSLGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O/c1-11-5-4-6-12(2)17(11)16-13(3)14-7-9-15(18)10-8-14/h7-12,18H,4-6H2,1-3H3.
What are the key properties of 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol?
4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol has a molecular weight of 246.35 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[N-(2,6-dimethylpiperidin-1-yl)-C-methylcarbonimidoyl]phenol is sourced from PubChem (CID 135796063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).