C16H22N4O — CID 135796714
7-amino-5-cyclohexyl-3,8-dimethyl-1H-1,3,4-benzotriazepin-2-one (PubChem CID 135796714) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is 7-amino-5-cyclohexyl-3,8-dimethyl-1H-1,3,4-benzotriazepin-2-one.
| Compound Name | 7-amino-5-cyclohexyl-3,8-dimethyl-1H-1,3,4-benzotriazepin-2-one |
|---|---|
| PubChem CID | 135796714 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 7-amino-5-cyclohexyl-3,8-dimethyl-1H-1,3,4-benzotriazepin-2-one |
| SMILES | Cc1cc2c(cc1N)C(C1CCCCC1)=NN(C)C(=O)N2 |
| InChI | InChI=1S/C16H22N4O/c1-10-8-14-12(9-13(10)17)15(11-6-4-3-5-7-11)19-20(2)16(21)18-14/h8-9,11H,3-7,17H2,1-2H3,(H,18,21) |
| InChIKey | ICWSMQSGYRTLBG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|