C34H29F3N2O4 — CID 135796795
2-[3-[3-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]phenyl]-2-methylpropanoic acid (PubChem CID 135796795) has the molecular formula C34H29F3N2O4 and a molecular weight of 586.61 g/mol. Its IUPAC name is 2-[3-[3-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135796795 |
| Molecular Formula | C34H29F3N2O4 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | 2-[3-[3-[[1-(3,5-dimethylphenyl)-2-hydroxy-6-(trifluoromethyl)indol-3-yl]methylideneamino]-2-hydroxyphenyl]phenyl]-2-methylpropanoic acid |
| SMILES | Cc1cc(C)cc(-n2c(O)c(/C=N/c3cccc(-c4cccc(C(C)(C)C(=O)O)c4)c3O)c3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C34H29F3N2O4/c1-19-13-20(2)15-24(14-19)39-29-17-23(34(35,36)37)11-12-26(29)27(31(39)41)18-38-28-10-6-9-25(30(28)40)21-7-5-8-22(16-21)33(3,4)32(42)43/h5-18,40-41H,1-4H3,(H,42,43)/b38-18+ |
| InChIKey | DLWZJYRDOKPKRA-CDLBOOTPSA-N |
| XLogP | 8.46 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|