C21H15F2N3O3S — CID 135797270
4-[(2,6-difluorophenyl)methyl]-5-methyl-2-[3-(4-nitrophenyl)prop-2-ynylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 135797270) has the molecular formula C21H15F2N3O3S and a molecular weight of 427.43 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methyl]-5-methyl-2-[3-(4-nitrophenyl)prop-2-ynylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,6-difluorophenyl)methyl]-5-methyl-2-[3-(4-nitrophenyl)prop-2-ynylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135797270 |
| Molecular Formula | C21H15F2N3O3S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methyl]-5-methyl-2-[3-(4-nitrophenyl)prop-2-ynylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | Cc1c(Cc2c(F)cccc2F)nc(SCC#Cc2ccc([N+](=O)[O-])cc2)[nH]c1=O |
| InChI | InChI=1S/C21H15F2N3O3S/c1-13-19(12-16-17(22)5-2-6-18(16)23)24-21(25-20(13)27)30-11-3-4-14-7-9-15(10-8-14)26(28)29/h2,5-10H,11-12H2,1H3,(H,24,25,27) |
| InChIKey | DCIIDJPHAMFYGI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|