C14H21NO7 — CID 135798480
methyl (E)-2-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate (PubChem CID 135798480) has the molecular formula C14H21NO7 and a molecular weight of 315.32 g/mol. Its IUPAC name is methyl (E)-2-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate.
| Compound Name | methyl (E)-2-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 135798480 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | methyl (E)-2-[(3aS,4S,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carboximidoyl]-3-hydroxybut-2-enoate |
| SMILES | [H]/N=C(C(\C(=O)OC)=C(\C)O)/[C@@H]1O[C@H](CO)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C14H21NO7/c1-6(17)8(13(18)19-4)9(15)11-12-10(7(5-16)20-11)21-14(2,3)22-12/h7,10-12,15-17H,5H2,1-4H3/b8-6+,15-9+/t7-,10-,11+,12-/m1/s1 |
| InChIKey | DSHLPDZCOKIHAT-HQQQTOJKSA-N |
| XLogP | 0.29 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|