About [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate
[(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate (PubChem CID 135798501) has the molecular formula C11H16N2O5
and a molecular weight of 256.26 g/mol. Its IUPAC name is [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate.
Molecular Properties
| Compound Name | [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate |
| PubChem CID | 135798501 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate |
| SMILES | CC(=O)O[C@@H](C(=[N+]=[N-])C(C)=O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H16N2O5/c1-6(14)9(13-12)10(17-7(2)15)8-5-16-11(3,4)18-8/h8,10H,5H2,1-4H3/t8-,10-/m1/s1 |
| InChIKey | FVAZDAGFVNYJKU-PSASIEDQSA-N |
| XLogP | 0.33 |
| TPSA | 98.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate?
The IUPAC name of [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate (CID 135798501) is [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate.
What is the SMILES notation for [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate?
The canonical SMILES for [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate is CC(=O)O[C@@H](C(=[N+]=[N-])C(C)=O)[C@H]1COC(C)(C)O1.
What is the InChIKey of [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate?
The InChIKey is FVAZDAGFVNYJKU-PSASIEDQSA-N. The full InChI is InChI=1S/C11H16N2O5/c1-6(14)9(13-12)10(17-7(2)15)8-5-16-11(3,4)18-8/h8,10H,5H2,1-4H3/t8-,10-/m1/s1.
What are the key properties of [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate?
[(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate has a molecular weight of 256.26 g/mol, XLogP of 0.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-diazo-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxobutyl] acetate is sourced from PubChem (CID 135798501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).