About (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide
(NE)-N-(1,3-thiazolidin-2-ylidene)nitramide (PubChem CID 135798723) has the molecular formula C3H5N3O2S
and a molecular weight of 147.16 g/mol. Its IUPAC name is (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide.
Molecular Properties
| Compound Name | (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide |
| PubChem CID | 135798723 |
| Molecular Formula | C3H5N3O2S |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.01 |
| IUPAC Name | (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide |
| SMILES | O=[N+]([O-])/N=C1\NCCS1 |
| InChI | InChI=1S/C3H5N3O2S/c7-6(8)5-3-4-1-2-9-3/h1-2H2,(H,4,5) |
| InChIKey | NFAYNHSHBXASAP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide?
The IUPAC name of (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide (CID 135798723) is (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide.
What is the SMILES notation for (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide?
The canonical SMILES for (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide is O=[N+]([O-])/N=C1\NCCS1.
What is the InChIKey of (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide?
The InChIKey is NFAYNHSHBXASAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2S/c7-6(8)5-3-4-1-2-9-3/h1-2H2,(H,4,5).
What are the key properties of (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide?
(NE)-N-(1,3-thiazolidin-2-ylidene)nitramide has a molecular weight of 147.16 g/mol, XLogP of -0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(1,3-thiazolidin-2-ylidene)nitramide is sourced from PubChem (CID 135798723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).