C21H16N4O2S — CID 135798913
21-ethoxy-17-hydroxy-2-imino-10-thia-3,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),4,6,8,11,14(19),15,17-octaene-12-carbonitrile (PubChem CID 135798913) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is 21-ethoxy-17-hydroxy-2-imino-10-thia-3,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),4,6,8,11,14(19),15,17-octaene-12-carbonitrile.
| Compound Name | 21-ethoxy-17-hydroxy-2-imino-10-thia-3,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),4,6,8,11,14(19),15,17-octaene-12-carbonitrile |
|---|---|
| PubChem CID | 135798913 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 21-ethoxy-17-hydroxy-2-imino-10-thia-3,20-diazapentacyclo[11.8.0.03,11.04,9.014,19]henicosa-1(21),4,6,8,11,14(19),15,17-octaene-12-carbonitrile |
| SMILES | [H]/N=C1/C2=C(OCC)Nc3cc(O)ccc3C2C(C#N)=C2Sc3ccccc3N21 |
| InChI | InChI=1S/C21H16N4O2S/c1-2-27-20-18-17(12-8-7-11(26)9-14(12)24-20)13(10-22)21-25(19(18)23)15-5-3-4-6-16(15)28-21/h3-9,17,23-24,26H,2H2,1H3/b23-19- |
| InChIKey | BGIBDJSOTSIQQE-NMWGTECJSA-N |
| XLogP | 4.49 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|