About (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea
(E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea (PubChem CID 135799272) has the molecular formula C9H6Cl2N4OS
and a molecular weight of 289.15 g/mol. Its IUPAC name is (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea.
Molecular Properties
| Compound Name | (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea |
| PubChem CID | 135799272 |
| Molecular Formula | C9H6Cl2N4OS |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea |
| SMILES | NC(=S)/N=N/c1[nH]c(O)c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C9H6Cl2N4OS/c10-3-1-4-6(5(11)2-3)8(16)13-7(4)14-15-9(12)17/h1-2,13,16H,(H2,12,17)/b15-14+ |
| InChIKey | LFAZPARIQUBYRS-CCEZHUSRSA-N |
| XLogP | 3.51 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea?
The IUPAC name of (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea (CID 135799272) is (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea.
What is the SMILES notation for (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea?
The canonical SMILES for (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea is NC(=S)/N=N/c1[nH]c(O)c2c(Cl)cc(Cl)cc12.
What is the InChIKey of (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea?
The InChIKey is LFAZPARIQUBYRS-CCEZHUSRSA-N. The full InChI is InChI=1S/C9H6Cl2N4OS/c10-3-1-4-6(5(11)2-3)8(16)13-7(4)14-15-9(12)17/h1-2,13,16H,(H2,12,17)/b15-14+.
What are the key properties of (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea?
(E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea has a molecular weight of 289.15 g/mol, XLogP of 3.51, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(4,6-dichloro-3-hydroxy-2H-isoindol-1-yl)iminothiourea is sourced from PubChem (CID 135799272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).