C11H13N5O4S2 — CID 135799426
2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide (PubChem CID 135799426) has the molecular formula C11H13N5O4S2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide.
| Compound Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 135799426 |
| Molecular Formula | C11H13N5O4S2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[(4-amino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]acetamide |
| SMILES | Nc1cc(=O)[nH]c(SCC(=O)NCCN2C(=O)CSC2=O)n1 |
| InChI | InChI=1S/C11H13N5O4S2/c12-6-3-7(17)15-10(14-6)21-4-8(18)13-1-2-16-9(19)5-22-11(16)20/h3H,1-2,4-5H2,(H,13,18)(H3,12,14,15,17) |
| InChIKey | GCRWVTJFZDZKQM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|