About 7-oxoazepane-2,2-dicarboxamide
7-oxoazepane-2,2-dicarboxamide (PubChem CID 135799851) has the molecular formula C8H13N3O3
and a molecular weight of 199.21 g/mol. Its IUPAC name is 7-oxoazepane-2,2-dicarboxamide.
Molecular Properties
| Compound Name | 7-oxoazepane-2,2-dicarboxamide |
| PubChem CID | 135799851 |
| Molecular Formula | C8H13N3O3 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 7-oxoazepane-2,2-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)CCCCC(=O)N1 |
| InChI | InChI=1S/C8H13N3O3/c9-6(13)8(7(10)14)4-2-1-3-5(12)11-8/h1-4H2,(H2,9,13)(H2,10,14)(H,11,12) |
| InChIKey | PYIKHHSSXFBAKJ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-oxoazepane-2,2-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxoazepane-2,2-dicarboxamide?
The IUPAC name of 7-oxoazepane-2,2-dicarboxamide (CID 135799851) is 7-oxoazepane-2,2-dicarboxamide.
What is the SMILES notation for 7-oxoazepane-2,2-dicarboxamide?
The canonical SMILES for 7-oxoazepane-2,2-dicarboxamide is NC(=O)C1(C(N)=O)CCCCC(=O)N1.
What is the InChIKey of 7-oxoazepane-2,2-dicarboxamide?
The InChIKey is PYIKHHSSXFBAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c9-6(13)8(7(10)14)4-2-1-3-5(12)11-8/h1-4H2,(H2,9,13)(H2,10,14)(H,11,12).
What are the key properties of 7-oxoazepane-2,2-dicarboxamide?
7-oxoazepane-2,2-dicarboxamide has a molecular weight of 199.21 g/mol, XLogP of -1.61, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxoazepane-2,2-dicarboxamide is sourced from PubChem (CID 135799851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).