C16H23N5O2 — CID 135800179
N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135800179) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135800179 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-[2-(2,6-dimethylpiperidin-1-yl)ethyl]-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | CC1CCCC(C)N1CCNc1n[n+]([O-])c2ccccc2[n+]1[O-] |
| InChI | InChI=1S/C16H23N5O2/c1-12-6-5-7-13(2)19(12)11-10-17-16-18-21(23)15-9-4-3-8-14(15)20(16)22/h3-4,8-9,12-13H,5-7,10-11H2,1-2H3,(H,17,18) |
| InChIKey | LZBWORQSRVOFPG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|