C15H22ClN5O2 — CID 135800181
N-(6-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine (PubChem CID 135800181) has the molecular formula C15H22ClN5O2 and a molecular weight of 339.83 g/mol. Its IUPAC name is N-(6-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine.
| Compound Name | N-(6-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 135800181 |
| Molecular Formula | C15H22ClN5O2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-(6-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-yl)-N',N'-dipropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CCNc1n[n+]([O-])c2ccc(Cl)cc2[n+]1[O-] |
| InChI | InChI=1S/C15H22ClN5O2/c1-3-8-19(9-4-2)10-7-17-15-18-21(23)13-6-5-12(16)11-14(13)20(15)22/h5-6,11H,3-4,7-10H2,1-2H3,(H,17,18) |
| InChIKey | BJSKOVWMBQSICW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|